C23H28FN5O2 — CID 143586098
1-[2-[4-[(4-amino-3-fluorophenyl)methylamino]piperidin-1-yl]ethyl]-7-methoxy-1,5-naphthyridin-2-one (PubChem CID 143586098) has the molecular formula C23H28FN5O2 and a molecular weight of 425.51 g/mol. Its IUPAC name is 1-[2-[4-[(4-amino-3-fluorophenyl)methylamino]piperidin-1-yl]ethyl]-7-methoxy-1,5-naphthyridin-2-one.
| Compound Name | 1-[2-[4-[(4-amino-3-fluorophenyl)methylamino]piperidin-1-yl]ethyl]-7-methoxy-1,5-naphthyridin-2-one |
|---|---|
| PubChem CID | 143586098 |
| Molecular Formula | C23H28FN5O2 |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 1-[2-[4-[(4-amino-3-fluorophenyl)methylamino]piperidin-1-yl]ethyl]-7-methoxy-1,5-naphthyridin-2-one |
| SMILES | COc1cnc2ccc(=O)n(CCN3CCC(NCc4ccc(N)c(F)c4)CC3)c2c1 |
| InChI | InChI=1S/C23H28FN5O2/c1-31-18-13-22-21(27-15-18)4-5-23(30)29(22)11-10-28-8-6-17(7-9-28)26-14-16-2-3-20(25)19(24)12-16/h2-5,12-13,15,17,26H,6-11,14,25H2,1H3 |
| InChIKey | CWSBZUOJFHPXDS-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|