C23H26ClN5O4 — CID 130210982
1-[2-[4-[(4-chloro-3-nitrophenyl)methylamino]piperidin-1-yl]ethyl]-7-methoxyquinoxalin-2-one (PubChem CID 130210982) has the molecular formula C23H26ClN5O4 and a molecular weight of 471.95 g/mol. Its IUPAC name is 1-[2-[4-[(4-chloro-3-nitrophenyl)methylamino]piperidin-1-yl]ethyl]-7-methoxyquinoxalin-2-one.
| Compound Name | 1-[2-[4-[(4-chloro-3-nitrophenyl)methylamino]piperidin-1-yl]ethyl]-7-methoxyquinoxalin-2-one |
|---|---|
| PubChem CID | 130210982 |
| Molecular Formula | C23H26ClN5O4 |
| Molecular Weight | 471.95 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 1-[2-[4-[(4-chloro-3-nitrophenyl)methylamino]piperidin-1-yl]ethyl]-7-methoxyquinoxalin-2-one |
| SMILES | COc1ccc2ncc(=O)n(CCN3CCC(NCc4ccc(Cl)c([N+](=O)[O-])c4)CC3)c2c1 |
| InChI | InChI=1S/C23H26ClN5O4/c1-33-18-3-5-20-22(13-18)28(23(30)15-26-20)11-10-27-8-6-17(7-9-27)25-14-16-2-4-19(24)21(12-16)29(31)32/h2-5,12-13,15,17,25H,6-11,14H2,1H3 |
| InChIKey | KOGINHVKPGVDAJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 102.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.95 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|