C21H30N4O4 — CID 123961295
[1-[2-(7-methoxy-2-oxoquinoxalin-1-yl)ethyl]piperidin-4-yl] N-tert-butylcarbamate (PubChem CID 123961295) has the molecular formula C21H30N4O4 and a molecular weight of 402.50 g/mol. Its IUPAC name is [1-[2-(7-methoxy-2-oxoquinoxalin-1-yl)ethyl]piperidin-4-yl] N-tert-butylcarbamate.
| Compound Name | [1-[2-(7-methoxy-2-oxoquinoxalin-1-yl)ethyl]piperidin-4-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 123961295 |
| Molecular Formula | C21H30N4O4 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | [1-[2-(7-methoxy-2-oxoquinoxalin-1-yl)ethyl]piperidin-4-yl] N-tert-butylcarbamate |
| SMILES | COc1ccc2ncc(=O)n(CCN3CCC(OC(=O)NC(C)(C)C)CC3)c2c1 |
| InChI | InChI=1S/C21H30N4O4/c1-21(2,3)23-20(27)29-15-7-9-24(10-8-15)11-12-25-18-13-16(28-4)5-6-17(18)22-14-19(25)26/h5-6,13-15H,7-12H2,1-4H3,(H,23,27) |
| InChIKey | AYKHXUFXFMTVBL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |