C16H23ClN4O3 — CID 172706824
1-[2-(4-amino-3-hydroxypiperidin-1-yl)ethyl]-7-methoxyquinoxalin-2-one;hydrochloride (PubChem CID 172706824) has the molecular formula C16H23ClN4O3 and a molecular weight of 354.84 g/mol. Its IUPAC name is 1-[2-(4-amino-3-hydroxypiperidin-1-yl)ethyl]-7-methoxyquinoxalin-2-one;hydrochloride.
| Compound Name | 1-[2-(4-amino-3-hydroxypiperidin-1-yl)ethyl]-7-methoxyquinoxalin-2-one;hydrochloride |
|---|---|
| PubChem CID | 172706824 |
| Molecular Formula | C16H23ClN4O3 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 1-[2-(4-amino-3-hydroxypiperidin-1-yl)ethyl]-7-methoxyquinoxalin-2-one;hydrochloride |
| SMILES | COc1ccc2ncc(=O)n(CCN3CCC(N)C(O)C3)c2c1.Cl |
| InChI | InChI=1S/C16H22N4O3.ClH/c1-23-11-2-3-13-14(8-11)20(16(22)9-18-13)7-6-19-5-4-12(17)15(21)10-19;/h2-3,8-9,12,15,21H,4-7,10,17H2,1H3;1H |
| InChIKey | DRTURWVUTCWADT-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |