C14H11FN4O2S — CID 143588181
N-(2-bicyclo[1.1.0]but-1-enylmethylsulfanylmethyl)-3-fluoro-5-formylpyrazolo[1,5-a]pyrimidine-7-carboxamide (PubChem CID 143588181) has the molecular formula C14H11FN4O2S and a molecular weight of 318.33 g/mol. Its IUPAC name is N-(2-bicyclo[1.1.0]but-1-enylmethylsulfanylmethyl)-3-fluoro-5-formylpyrazolo[1,5-a]pyrimidine-7-carboxamide.
| Compound Name | N-(2-bicyclo[1.1.0]but-1-enylmethylsulfanylmethyl)-3-fluoro-5-formylpyrazolo[1,5-a]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 143588181 |
| Molecular Formula | C14H11FN4O2S |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | N-(2-bicyclo[1.1.0]but-1-enylmethylsulfanylmethyl)-3-fluoro-5-formylpyrazolo[1,5-a]pyrimidine-7-carboxamide |
| SMILES | O=Cc1cc(C(=O)NCSCC2=C3CC23)n2ncc(F)c2n1 |
| InChI | InChI=1S/C14H11FN4O2S/c15-11-3-17-19-12(1-7(4-20)18-13(11)19)14(21)16-6-22-5-10-8-2-9(8)10/h1,3-4,8H,2,5-6H2,(H,16,21) |
| InChIKey | ZALAPYZJYGQQEV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|