C11H13FN4O — CID 143590467
7-cyclopentyl-2-(fluoroamino)-5H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 143590467) has the molecular formula C11H13FN4O and a molecular weight of 236.25 g/mol. Its IUPAC name is 7-cyclopentyl-2-(fluoroamino)-5H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 7-cyclopentyl-2-(fluoroamino)-5H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 143590467 |
| Molecular Formula | C11H13FN4O |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 7-cyclopentyl-2-(fluoroamino)-5H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | O=C1Cc2cnc(NF)nc2N1C1CCCC1 |
| InChI | InChI=1S/C11H13FN4O/c12-15-11-13-6-7-5-9(17)16(10(7)14-11)8-3-1-2-4-8/h6,8H,1-5H2,(H,13,14,15) |
| InChIKey | YFOVVWYOJDFIFY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|