C21H28IN3O — CID 143590862
N-(4-tert-butylphenyl)-4-(3-methyl-2-pyridinyl)-1λ3,4-iodazinane-1-carboxamide (PubChem CID 143590862) has the molecular formula C21H28IN3O and a molecular weight of 465.38 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-4-(3-methyl-2-pyridinyl)-1λ3,4-iodazinane-1-carboxamide.
| Compound Name | N-(4-tert-butylphenyl)-4-(3-methyl-2-pyridinyl)-1λ3,4-iodazinane-1-carboxamide |
|---|---|
| PubChem CID | 143590862 |
| Molecular Formula | C21H28IN3O |
| Molecular Weight | 465.38 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | N-(4-tert-butylphenyl)-4-(3-methyl-2-pyridinyl)-1λ3,4-iodazinane-1-carboxamide |
| SMILES | Cc1cccnc1N1CCI(C(=O)Nc2ccc(C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C21H28IN3O/c1-16-6-5-13-23-19(16)25-14-11-22(12-15-25)20(26)24-18-9-7-17(8-10-18)21(2,3)4/h5-10,13H,11-12,14-15H2,1-4H3,(H,24,26) |
| InChIKey | VCPLFLVMLQBLIK-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.38 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|