C33H52N2O2 — CID 143591220
[(E)-[(1R,3aS,5aR,5bR,11aR)-1-tert-butyl-3a-cyano-5a,5b,8,8,11a-pentamethyl-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-9-ylidene]amino] acetate (PubChem CID 143591220) has the molecular formula C33H52N2O2 and a molecular weight of 508.79 g/mol. Its IUPAC name is [(E)-[(1R,3aS,5aR,5bR,11aR)-1-tert-butyl-3a-cyano-5a,5b,8,8,11a-pentamethyl-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-9-ylidene]amino] acetate.
| Compound Name | [(E)-[(1R,3aS,5aR,5bR,11aR)-1-tert-butyl-3a-cyano-5a,5b,8,8,11a-pentamethyl-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-9-ylidene]amino] acetate |
|---|---|
| PubChem CID | 143591220 |
| Molecular Formula | C33H52N2O2 |
| Molecular Weight | 508.79 g/mol |
| Exact Mass | 508.40 |
| IUPAC Name | [(E)-[(1R,3aS,5aR,5bR,11aR)-1-tert-butyl-3a-cyano-5a,5b,8,8,11a-pentamethyl-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-9-ylidene]amino] acetate |
| SMILES | CC(=O)O/N=C1\CC[C@@]2(C)C(CC[C@]3(C)C2CCC2C4C(C(C)(C)C)CC[C@]4(C#N)CC[C@]23C)C1(C)C |
| InChI | InChI=1S/C33H52N2O2/c1-21(36)37-35-26-14-15-30(7)24(29(26,5)6)13-16-32(9)25(30)11-10-23-27-22(28(2,3)4)12-17-33(27,20-34)19-18-31(23,32)8/h22-25,27H,10-19H2,1-9H3/b35-26+/t22?,23?,24?,25?,27?,30-,31+,32+,33+/m0/s1 |
| InChIKey | OIHJRBGIFASSBO-GMLLNRPKSA-N |
| XLogP | 8.56 |
| TPSA | 62.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.79 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|