C31H53NO2 — CID 143591267
[(4aR)-2,4a,4b,7,7,10a-hexamethyl-8-nitroso-1-propyl-3,4,5,6,6a,8,9,10,10b,11,12,12a-dodecahydro-1H-chrysen-2-yl]methanol;prop-1-yne (PubChem CID 143591267) has the molecular formula C31H53NO2 and a molecular weight of 471.77 g/mol. Its IUPAC name is [(4aR)-2,4a,4b,7,7,10a-hexamethyl-8-nitroso-1-propyl-3,4,5,6,6a,8,9,10,10b,11,12,12a-dodecahydro-1H-chrysen-2-yl]methanol;prop-1-yne.
| Compound Name | [(4aR)-2,4a,4b,7,7,10a-hexamethyl-8-nitroso-1-propyl-3,4,5,6,6a,8,9,10,10b,11,12,12a-dodecahydro-1H-chrysen-2-yl]methanol;prop-1-yne |
|---|---|
| PubChem CID | 143591267 |
| Molecular Formula | C31H53NO2 |
| Molecular Weight | 471.77 g/mol |
| Exact Mass | 471.41 |
| IUPAC Name | [(4aR)-2,4a,4b,7,7,10a-hexamethyl-8-nitroso-1-propyl-3,4,5,6,6a,8,9,10,10b,11,12,12a-dodecahydro-1H-chrysen-2-yl]methanol;prop-1-yne |
| SMILES | C#CC.CCCC1C2CCC3C4(C)CCC(N=O)C(C)(C)C4CCC3(C)[C@]2(C)CCC1(C)CO |
| InChI | InChI=1S/C28H49NO2.C3H4/c1-8-9-19-20-10-11-22-26(5)14-13-23(29-31)24(2,3)21(26)12-15-28(22,7)27(20,6)17-16-25(19,4)18-30;1-3-2/h19-23,30H,8-18H2,1-7H3;1H,2H3/t19?,20?,21?,22?,23?,25?,26?,27-,28?;/m1./s1 |
| InChIKey | OGWSDQJKDIHPCS-MGPFLXIISA-N |
| XLogP | 8.24 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.77 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|