C32H55NO — CID 143591383
(4aR)-2-ethyl-2,4a,4b,7,7,10a-hexamethyl-1-(2-methylpent-1-en-3-yl)-8-nitroso-3,4,5,6,6a,8,9,10,10b,11,12,12a-dodecahydro-1H-chrysene (PubChem CID 143591383) has the molecular formula C32H55NO and a molecular weight of 469.80 g/mol. Its IUPAC name is (4aR)-2-ethyl-2,4a,4b,7,7,10a-hexamethyl-1-(2-methylpent-1-en-3-yl)-8-nitroso-3,4,5,6,6a,8,9,10,10b,11,12,12a-dodecahydro-1H-chrysene.
| Compound Name | (4aR)-2-ethyl-2,4a,4b,7,7,10a-hexamethyl-1-(2-methylpent-1-en-3-yl)-8-nitroso-3,4,5,6,6a,8,9,10,10b,11,12,12a-dodecahydro-1H-chrysene |
|---|---|
| PubChem CID | 143591383 |
| Molecular Formula | C32H55NO |
| Molecular Weight | 469.80 g/mol |
| Exact Mass | 469.43 |
| IUPAC Name | (4aR)-2-ethyl-2,4a,4b,7,7,10a-hexamethyl-1-(2-methylpent-1-en-3-yl)-8-nitroso-3,4,5,6,6a,8,9,10,10b,11,12,12a-dodecahydro-1H-chrysene |
| SMILES | C=C(C)C(CC)C1C2CCC3C4(C)CCC(N=O)C(C)(C)C4CCC3(C)[C@]2(C)CCC1(C)CC |
| InChI | InChI=1S/C32H55NO/c1-11-22(21(3)4)27-23-13-14-25-30(8)17-16-26(33-34)28(5,6)24(30)15-18-32(25,10)31(23,9)20-19-29(27,7)12-2/h22-27H,3,11-20H2,1-2,4-10H3/t22?,23?,24?,25?,26?,27?,29?,30?,31-,32?/m1/s1 |
| InChIKey | LFVMWTYPUAMLIQ-SNPVUBSUSA-N |
| XLogP | 9.83 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.80 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|