C34H60N2 — CID 59042364
2-[2,4a,4b,7,7,8,10a-heptamethyl-1-(3-methylbut-3-en-2-yl)-3,4,5,6,6a,8,9,10,10b,11,12,12a-dodecahydro-1H-chrysen-2-yl]-N-[(E)-ethylideneamino]ethanamine (PubChem CID 59042364) has the molecular formula C34H60N2 and a molecular weight of 496.87 g/mol. Its IUPAC name is 2-[2,4a,4b,7,7,8,10a-heptamethyl-1-(3-methylbut-3-en-2-yl)-3,4,5,6,6a,8,9,10,10b,11,12,12a-dodecahydro-1H-chrysen-2-yl]-N-[(E)-ethylideneamino]ethanamine.
| Compound Name | 2-[2,4a,4b,7,7,8,10a-heptamethyl-1-(3-methylbut-3-en-2-yl)-3,4,5,6,6a,8,9,10,10b,11,12,12a-dodecahydro-1H-chrysen-2-yl]-N-[(E)-ethylideneamino]ethanamine |
|---|---|
| PubChem CID | 59042364 |
| Molecular Formula | C34H60N2 |
| Molecular Weight | 496.87 g/mol |
| Exact Mass | 496.48 |
| IUPAC Name | 2-[2,4a,4b,7,7,8,10a-heptamethyl-1-(3-methylbut-3-en-2-yl)-3,4,5,6,6a,8,9,10,10b,11,12,12a-dodecahydro-1H-chrysen-2-yl]-N-[(E)-ethylideneamino]ethanamine |
| SMILES | C=C(C)C(C)C1C2CCC3C4(C)CCC(C)C(C)(C)C4CCC3(C)C2(C)CCC1(C)CCN/N=C/C |
| InChI | InChI=1S/C34H60N2/c1-12-35-36-22-21-31(8)19-20-33(10)26(29(31)25(5)23(2)3)13-14-28-32(9)17-15-24(4)30(6,7)27(32)16-18-34(28,33)11/h12,24-29,36H,2,13-22H2,1,3-11H3/b35-12+ |
| InChIKey | WMKJHGGZXPMHOQ-RHQFVSDJSA-N |
| XLogP | 9.51 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.87 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|