C28H39N5O — CID 143595336
1-[2-(4-cyclobutylpiperazin-1-yl)-5,6,7,9,10,11-hexahydropyrimido[4,5-e]azonin-8-yl]-2-(3-methylcyclohepta-1,3,5-trien-1-yl)ethanone (PubChem CID 143595336) has the molecular formula C28H39N5O and a molecular weight of 461.65 g/mol. Its IUPAC name is 1-[2-(4-cyclobutylpiperazin-1-yl)-5,6,7,9,10,11-hexahydropyrimido[4,5-e]azonin-8-yl]-2-(3-methylcyclohepta-1,3,5-trien-1-yl)ethanone.
| Compound Name | 1-[2-(4-cyclobutylpiperazin-1-yl)-5,6,7,9,10,11-hexahydropyrimido[4,5-e]azonin-8-yl]-2-(3-methylcyclohepta-1,3,5-trien-1-yl)ethanone |
|---|---|
| PubChem CID | 143595336 |
| Molecular Formula | C28H39N5O |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.32 |
| IUPAC Name | 1-[2-(4-cyclobutylpiperazin-1-yl)-5,6,7,9,10,11-hexahydropyrimido[4,5-e]azonin-8-yl]-2-(3-methylcyclohepta-1,3,5-trien-1-yl)ethanone |
| SMILES | CC1=CC=CCC(CC(=O)N2CCCc3cnc(N4CCN(C5CCC5)CC4)nc3CCC2)=C1 |
| InChI | InChI=1S/C28H39N5O/c1-22-7-2-3-8-23(19-22)20-27(34)32-13-5-9-24-21-29-28(30-26(24)12-6-14-32)33-17-15-31(16-18-33)25-10-4-11-25/h2-3,7,19,21,25H,4-6,8-18,20H2,1H3 |
| InChIKey | UEKQNGQRBXNPAZ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |