C26H35N5O — CID 59670416
[2-(4-cyclobutylpiperazin-1-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-(2,4,6-trimethylphenyl)methanone (PubChem CID 59670416) has the molecular formula C26H35N5O and a molecular weight of 433.60 g/mol. Its IUPAC name is [2-(4-cyclobutylpiperazin-1-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-(2,4,6-trimethylphenyl)methanone.
| Compound Name | [2-(4-cyclobutylpiperazin-1-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 59670416 |
| Molecular Formula | C26H35N5O |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.28 |
| IUPAC Name | [2-(4-cyclobutylpiperazin-1-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-(2,4,6-trimethylphenyl)methanone |
| SMILES | Cc1cc(C)c(C(=O)N2CCc3cnc(N4CCN(C5CCC5)CC4)nc3CC2)c(C)c1 |
| InChI | InChI=1S/C26H35N5O/c1-18-15-19(2)24(20(3)16-18)25(32)30-9-7-21-17-27-26(28-23(21)8-10-30)31-13-11-29(12-14-31)22-5-4-6-22/h15-17,22H,4-14H2,1-3H3 |
| InChIKey | UHWVRCITLKLOOJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |