C27H30Cl2N6O2 — CID 59670450
[2-(4-cyclobutylpiperazin-1-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]methanone (PubChem CID 59670450) has the molecular formula C27H30Cl2N6O2 and a molecular weight of 541.48 g/mol. Its IUPAC name is [2-(4-cyclobutylpiperazin-1-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]methanone.
| Compound Name | [2-(4-cyclobutylpiperazin-1-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]methanone |
|---|---|
| PubChem CID | 59670450 |
| Molecular Formula | C27H30Cl2N6O2 |
| Molecular Weight | 541.48 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | [2-(4-cyclobutylpiperazin-1-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]methanone |
| SMILES | Cc1onc(-c2c(Cl)cccc2Cl)c1C(=O)N1CCc2cnc(N3CCN(C4CCC4)CC3)nc2CC1 |
| InChI | InChI=1S/C27H30Cl2N6O2/c1-17-23(25(32-37-17)24-20(28)6-3-7-21(24)29)26(36)34-10-8-18-16-30-27(31-22(18)9-11-34)35-14-12-33(13-15-35)19-4-2-5-19/h3,6-7,16,19H,2,4-5,8-15H2,1H3 |
| InChIKey | YCSDWCZGTCHBHG-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 78.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |