C11H21NO — CID 143595513
(4E,6E)-8-(propylamino)octa-4,6-dien-4-ol (PubChem CID 143595513) has the molecular formula C11H21NO and a molecular weight of 183.30 g/mol. Its IUPAC name is (4E,6E)-8-(propylamino)octa-4,6-dien-4-ol.
| Compound Name | (4E,6E)-8-(propylamino)octa-4,6-dien-4-ol |
|---|---|
| PubChem CID | 143595513 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | (4E,6E)-8-(propylamino)octa-4,6-dien-4-ol |
| SMILES | CCCNC/C=C/C=C(/O)CCC |
| InChI | InChI=1S/C11H21NO/c1-3-7-11(13)8-5-6-10-12-9-4-2/h5-6,8,12-13H,3-4,7,9-10H2,1-2H3/b6-5+,11-8+ |
| InChIKey | QHDPHAGJBVVGKT-BXROQLSZSA-N |
| XLogP | 2.78 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|