C12H25NO2 — CID 142957686
ethane;(4Z,6E)-3-(2-hydroxyethylamino)octa-4,6-dien-4-ol (PubChem CID 142957686) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is ethane;(4Z,6E)-3-(2-hydroxyethylamino)octa-4,6-dien-4-ol.
| Compound Name | ethane;(4Z,6E)-3-(2-hydroxyethylamino)octa-4,6-dien-4-ol |
|---|---|
| PubChem CID | 142957686 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | ethane;(4Z,6E)-3-(2-hydroxyethylamino)octa-4,6-dien-4-ol |
| SMILES | C/C=C/C=C(\O)C(CC)NCCO.CC |
| InChI | InChI=1S/C10H19NO2.C2H6/c1-3-5-6-10(13)9(4-2)11-7-8-12;1-2/h3,5-6,9,11-13H,4,7-8H2,1-2H3;1-2H3/b5-3+,10-6-; |
| InChIKey | SIVFYRIVTJPTEC-JFXKHEIASA-N |
| XLogP | 2.39 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|