C9H19NO2 — CID 89102558
(E,2R,3S)-2-(propan-2-ylamino)hex-4-ene-1,3-diol (PubChem CID 89102558) has the molecular formula C9H19NO2 and a molecular weight of 173.26 g/mol. Its IUPAC name is (E,2R,3S)-2-(propan-2-ylamino)hex-4-ene-1,3-diol.
| Compound Name | (E,2R,3S)-2-(propan-2-ylamino)hex-4-ene-1,3-diol |
|---|---|
| PubChem CID | 89102558 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | (E,2R,3S)-2-(propan-2-ylamino)hex-4-ene-1,3-diol |
| SMILES | C/C=C/[C@H](O)[C@@H](CO)NC(C)C |
| InChI | InChI=1S/C9H19NO2/c1-4-5-9(12)8(6-11)10-7(2)3/h4-5,7-12H,6H2,1-3H3/b5-4+/t8-,9+/m1/s1 |
| InChIKey | MRAWNXOKKOYCSP-VJIGKBMESA-N |
| XLogP | 0.28 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|