C11H18N4 — CID 143595919
1-methyl-6-methylidene-4-[(Z)-1-methyliminobut-2-en-2-yl]-4,5-dihydropyrimidin-2-amine (PubChem CID 143595919) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is 1-methyl-6-methylidene-4-[(Z)-1-methyliminobut-2-en-2-yl]-4,5-dihydropyrimidin-2-amine.
| Compound Name | 1-methyl-6-methylidene-4-[(Z)-1-methyliminobut-2-en-2-yl]-4,5-dihydropyrimidin-2-amine |
|---|---|
| PubChem CID | 143595919 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 1-methyl-6-methylidene-4-[(Z)-1-methyliminobut-2-en-2-yl]-4,5-dihydropyrimidin-2-amine |
| SMILES | C=C1CC(C(=C/C)/C=N/C)N=C(N)N1C |
| InChI | InChI=1S/C11H18N4/c1-5-9(7-13-3)10-6-8(2)15(4)11(12)14-10/h5,7,10H,2,6H2,1,3-4H3,(H2,12,14)/b9-5+,13-7+ |
| InChIKey | NUYOVXAWAYSJNJ-MHUSLGGSSA-N |
| XLogP | 1.17 |
| TPSA | 53.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|