C13H22N3+ — CID 123921130
4-methyl-3,5-dimethylidene-N-(4-methylpent-2-en-3-yl)-2,4-dihydropyrimidin-3-ium-6-amine (PubChem CID 123921130) has the molecular formula C13H22N3+ and a molecular weight of 220.34 g/mol. Its IUPAC name is 4-methyl-3,5-dimethylidene-N-(4-methylpent-2-en-3-yl)-2,4-dihydropyrimidin-3-ium-6-amine.
| Compound Name | 4-methyl-3,5-dimethylidene-N-(4-methylpent-2-en-3-yl)-2,4-dihydropyrimidin-3-ium-6-amine |
|---|---|
| PubChem CID | 123921130 |
| Molecular Formula | C13H22N3+ |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 4-methyl-3,5-dimethylidene-N-(4-methylpent-2-en-3-yl)-2,4-dihydropyrimidin-3-ium-6-amine |
| SMILES | C=C1C(NC(=CC)C(C)C)=NC[N+](=C)C1C |
| InChI | InChI=1S/C13H22N3/c1-7-12(9(2)3)15-13-10(4)11(5)16(6)8-14-13/h7,9,11H,4,6,8H2,1-3,5H3,(H,14,15)/q+1 |
| InChIKey | HOMHORFWDRGWIA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 27.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|