C10H15F3N2 — CID 143596338
(5E)-7,7,7-trifluoro-6-methyl-N-[(methylideneamino)methyl]hepta-1,5-dien-3-amine (PubChem CID 143596338) has the molecular formula C10H15F3N2 and a molecular weight of 220.24 g/mol. Its IUPAC name is (5E)-7,7,7-trifluoro-6-methyl-N-[(methylideneamino)methyl]hepta-1,5-dien-3-amine.
| Compound Name | (5E)-7,7,7-trifluoro-6-methyl-N-[(methylideneamino)methyl]hepta-1,5-dien-3-amine |
|---|---|
| PubChem CID | 143596338 |
| Molecular Formula | C10H15F3N2 |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | (5E)-7,7,7-trifluoro-6-methyl-N-[(methylideneamino)methyl]hepta-1,5-dien-3-amine |
| SMILES | C=CC(C/C=C(\C)C(F)(F)F)NCN=C |
| InChI | InChI=1S/C10H15F3N2/c1-4-9(15-7-14-3)6-5-8(2)10(11,12)13/h4-5,9,15H,1,3,6-7H2,2H3/b8-5+ |
| InChIKey | VMCAWWCNCQTSAI-VMPITWQZSA-N |
| XLogP | 2.69 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|