C10H14F2N2 — CID 143596357
4-(difluoromethyl)-N-[1-(methylideneamino)ethyl]cyclohexa-2,4-dien-1-amine (PubChem CID 143596357) has the molecular formula C10H14F2N2 and a molecular weight of 200.23 g/mol. Its IUPAC name is 4-(difluoromethyl)-N-[1-(methylideneamino)ethyl]cyclohexa-2,4-dien-1-amine.
| Compound Name | 4-(difluoromethyl)-N-[1-(methylideneamino)ethyl]cyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 143596357 |
| Molecular Formula | C10H14F2N2 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 4-(difluoromethyl)-N-[1-(methylideneamino)ethyl]cyclohexa-2,4-dien-1-amine |
| SMILES | C=NC(C)NC1C=CC(C(F)F)=CC1 |
| InChI | InChI=1S/C10H14F2N2/c1-7(13-2)14-9-5-3-8(4-6-9)10(11)12/h3-5,7,9-10,14H,2,6H2,1H3 |
| InChIKey | AXCNUFVAECTODU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|