C21H28N2 — CID 143721734
(2Z,4Z,6Z)-N-[(2E)-2-[(6Z)-6-ethylidenecyclohexa-2,4-dien-1-ylidene]propyl]-3-methyl-1-(methylideneamino)octa-2,4,6-trien-1-amine (PubChem CID 143721734) has the molecular formula C21H28N2 and a molecular weight of 308.47 g/mol. Its IUPAC name is (2Z,4Z,6Z)-N-[(2E)-2-[(6Z)-6-ethylidenecyclohexa-2,4-dien-1-ylidene]propyl]-3-methyl-1-(methylideneamino)octa-2,4,6-trien-1-amine.
| Compound Name | (2Z,4Z,6Z)-N-[(2E)-2-[(6Z)-6-ethylidenecyclohexa-2,4-dien-1-ylidene]propyl]-3-methyl-1-(methylideneamino)octa-2,4,6-trien-1-amine |
|---|---|
| PubChem CID | 143721734 |
| Molecular Formula | C21H28N2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | (2Z,4Z,6Z)-N-[(2E)-2-[(6Z)-6-ethylidenecyclohexa-2,4-dien-1-ylidene]propyl]-3-methyl-1-(methylideneamino)octa-2,4,6-trien-1-amine |
| SMILES | C=NC(/C=C(C)\C=C/C=C\C)NC/C(C)=c1\cccc\c1=C\C |
| InChI | InChI=1S/C21H28N2/c1-6-8-9-12-17(3)15-21(22-5)23-16-18(4)20-14-11-10-13-19(20)7-2/h6-15,21,23H,5,16H2,1-4H3/b8-6-,12-9-,17-15-,19-7-,20-18+ |
| InChIKey | DCLDLDVQLXAWTL-VZBXTUFDSA-N |
| XLogP | 3.35 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|