C13H23N3 — CID 145011924
N'-[(E)-1-[[(2E)-2,4-dimethylpenta-2,4-dienyl]amino]-2-methylbut-2-enyl]methanimidamide (PubChem CID 145011924) has the molecular formula C13H23N3 and a molecular weight of 221.35 g/mol. Its IUPAC name is N'-[(E)-1-[[(2E)-2,4-dimethylpenta-2,4-dienyl]amino]-2-methylbut-2-enyl]methanimidamide.
| Compound Name | N'-[(E)-1-[[(2E)-2,4-dimethylpenta-2,4-dienyl]amino]-2-methylbut-2-enyl]methanimidamide |
|---|---|
| PubChem CID | 145011924 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | N'-[(E)-1-[[(2E)-2,4-dimethylpenta-2,4-dienyl]amino]-2-methylbut-2-enyl]methanimidamide |
| SMILES | C=C(C)/C=C(\C)CNC(/N=C\N)/C(C)=C/C |
| InChI | InChI=1S/C13H23N3/c1-6-12(5)13(16-9-14)15-8-11(4)7-10(2)3/h6-7,9,13,15H,2,8H2,1,3-5H3,(H2,14,16)/b11-7+,12-6+ |
| InChIKey | FSEMOZJUXPRLRA-IAVOFVOCSA-N |
| XLogP | 2.38 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|