C10H19N3 — CID 145087338
methanamine;N'-[(3Z)-5-methyl-2-methylidenehexa-3,5-dienyl]methanimidamide (PubChem CID 145087338) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is methanamine;N'-[(3Z)-5-methyl-2-methylidenehexa-3,5-dienyl]methanimidamide.
| Compound Name | methanamine;N'-[(3Z)-5-methyl-2-methylidenehexa-3,5-dienyl]methanimidamide |
|---|---|
| PubChem CID | 145087338 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | methanamine;N'-[(3Z)-5-methyl-2-methylidenehexa-3,5-dienyl]methanimidamide |
| SMILES | C=C(C)/C=C\C(=C)C/N=C/N.CN |
| InChI | InChI=1S/C9H14N2.CH5N/c1-8(2)4-5-9(3)6-11-7-10;1-2/h4-5,7H,1,3,6H2,2H3,(H2,10,11);2H2,1H3/b5-4-; |
| InChIKey | DPMQUAPJEQLLLG-MKWAYWHRSA-N |
| XLogP | 1.24 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|