C11H18N2 — CID 163245515
N'-[(2E,4Z)-3,7-dimethylocta-2,4,6-trienyl]methanimidamide (PubChem CID 163245515) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is N'-[(2E,4Z)-3,7-dimethylocta-2,4,6-trienyl]methanimidamide.
| Compound Name | N'-[(2E,4Z)-3,7-dimethylocta-2,4,6-trienyl]methanimidamide |
|---|---|
| PubChem CID | 163245515 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | N'-[(2E,4Z)-3,7-dimethylocta-2,4,6-trienyl]methanimidamide |
| SMILES | CC(C)=C/C=C\C(C)=C\C/N=C/N |
| InChI | InChI=1S/C11H18N2/c1-10(2)5-4-6-11(3)7-8-13-9-12/h4-7,9H,8H2,1-3H3,(H2,12,13)/b6-4-,11-7+ |
| InChIKey | UVQXSOPTIUBWLL-WXVRQDIQSA-N |
| XLogP | 2.44 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|