C9H12N2 — CID 142302141
N-(5-ethenyl-2-methyl-1,2-dihydropyridin-6-yl)methanimine (PubChem CID 142302141) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is N-(5-ethenyl-2-methyl-1,2-dihydropyridin-6-yl)methanimine.
| Compound Name | N-(5-ethenyl-2-methyl-1,2-dihydropyridin-6-yl)methanimine |
|---|---|
| PubChem CID | 142302141 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | N-(5-ethenyl-2-methyl-1,2-dihydropyridin-6-yl)methanimine |
| SMILES | C=CC1=C(N=C)NC(C)C=C1 |
| InChI | InChI=1S/C9H12N2/c1-4-8-6-5-7(2)11-9(8)10-3/h4-7,11H,1,3H2,2H3 |
| InChIKey | IXLDRNYFWDWRFP-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|