C8H14N2 — CID 144519533
N'-(3-methylcyclohexa-2,4-dien-1-yl)methanediamine (PubChem CID 144519533) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is N'-(3-methylcyclohexa-2,4-dien-1-yl)methanediamine.
| Compound Name | N'-(3-methylcyclohexa-2,4-dien-1-yl)methanediamine |
|---|---|
| PubChem CID | 144519533 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | N'-(3-methylcyclohexa-2,4-dien-1-yl)methanediamine |
| SMILES | CC1=CC(NCN)CC=C1 |
| InChI | InChI=1S/C8H14N2/c1-7-3-2-4-8(5-7)10-6-9/h2-3,5,8,10H,4,6,9H2,1H3 |
| InChIKey | COOOGWNKNONYCL-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|