C8H13N — CID 22084990
N,6-dimethylcyclohexa-2,4-dien-1-amine (PubChem CID 22084990) has the molecular formula C8H13N and a molecular weight of 123.20 g/mol. Its IUPAC name is N,6-dimethylcyclohexa-2,4-dien-1-amine.
| Compound Name | N,6-dimethylcyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 22084990 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | N,6-dimethylcyclohexa-2,4-dien-1-amine |
| SMILES | CNC1C=CC=CC1C |
| InChI | InChI=1S/C8H13N/c1-7-5-3-4-6-8(7)9-2/h3-9H,1-2H3 |
| InChIKey | LHYMTFBKVHDFLH-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |