C7H9F2N — CID 118423018
5,6-difluoro-N-methylcyclohexa-2,4-dien-1-amine (PubChem CID 118423018) has the molecular formula C7H9F2N and a molecular weight of 145.15 g/mol. Its IUPAC name is 5,6-difluoro-N-methylcyclohexa-2,4-dien-1-amine.
| Compound Name | 5,6-difluoro-N-methylcyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 118423018 |
| Molecular Formula | C7H9F2N |
| Molecular Weight | 145.15 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | 5,6-difluoro-N-methylcyclohexa-2,4-dien-1-amine |
| SMILES | CNC1C=CC=C(F)C1F |
| InChI | InChI=1S/C7H9F2N/c1-10-6-4-2-3-5(8)7(6)9/h2-4,6-7,10H,1H3 |
| InChIKey | PRXBUZTVDZZAGF-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.15 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |