C10H16N2 — CID 143597093
(2Z,4Z)-4-methyl-5-[(methylideneamino)methyl]hepta-2,4,6-trien-1-amine (PubChem CID 143597093) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is (2Z,4Z)-4-methyl-5-[(methylideneamino)methyl]hepta-2,4,6-trien-1-amine.
| Compound Name | (2Z,4Z)-4-methyl-5-[(methylideneamino)methyl]hepta-2,4,6-trien-1-amine |
|---|---|
| PubChem CID | 143597093 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | (2Z,4Z)-4-methyl-5-[(methylideneamino)methyl]hepta-2,4,6-trien-1-amine |
| SMILES | C=C/C(CN=C)=C(C)/C=C\CN |
| InChI | InChI=1S/C10H16N2/c1-4-10(8-12-3)9(2)6-5-7-11/h4-6H,1,3,7-8,11H2,2H3/b6-5-,10-9- |
| InChIKey | KCICNNILULOKFS-WBHJMADESA-N |
| XLogP | 1.70 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|