C9H17N — CID 55285711
(2E,4E)-4-ethylhepta-2,4-dien-1-amine (PubChem CID 55285711) has the molecular formula C9H17N and a molecular weight of 139.24 g/mol. Its IUPAC name is (2E,4E)-4-ethylhepta-2,4-dien-1-amine.
| Compound Name | (2E,4E)-4-ethylhepta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 55285711 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | (2E,4E)-4-ethylhepta-2,4-dien-1-amine |
| SMILES | CC/C=C(/C=C/CN)CC |
| InChI | InChI=1S/C9H17N/c1-3-6-9(4-2)7-5-8-10/h5-7H,3-4,8,10H2,1-2H3/b7-5+,9-6+ |
| InChIKey | UXPKFMWLWATIJN-PDTNFJSOSA-N |
| XLogP | 2.25 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|