About benzyl 2-(1H-indol-4-yl)acetate
benzyl 2-(1H-indol-4-yl)acetate (PubChem CID 143599585) has the molecular formula C17H15NO2
and a molecular weight of 265.31 g/mol. Its IUPAC name is benzyl 2-(1H-indol-4-yl)acetate.
Molecular Properties
| Compound Name | benzyl 2-(1H-indol-4-yl)acetate |
| PubChem CID | 143599585 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | benzyl 2-(1H-indol-4-yl)acetate |
| SMILES | O=C(Cc1cccc2[nH]ccc12)OCc1ccccc1 |
| InChI | InChI=1S/C17H15NO2/c19-17(20-12-13-5-2-1-3-6-13)11-14-7-4-8-16-15(14)9-10-18-16/h1-10,18H,11-12H2 |
| InChIKey | XHOLWENGJSBGJX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzyl 2-(1H-indol-4-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-(1H-indol-4-yl)acetate?
The IUPAC name of benzyl 2-(1H-indol-4-yl)acetate (CID 143599585) is benzyl 2-(1H-indol-4-yl)acetate.
What is the SMILES notation for benzyl 2-(1H-indol-4-yl)acetate?
The canonical SMILES for benzyl 2-(1H-indol-4-yl)acetate is O=C(Cc1cccc2[nH]ccc12)OCc1ccccc1.
What is the InChIKey of benzyl 2-(1H-indol-4-yl)acetate?
The InChIKey is XHOLWENGJSBGJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO2/c19-17(20-12-13-5-2-1-3-6-13)11-14-7-4-8-16-15(14)9-10-18-16/h1-10,18H,11-12H2.
What are the key properties of benzyl 2-(1H-indol-4-yl)acetate?
benzyl 2-(1H-indol-4-yl)acetate has a molecular weight of 265.31 g/mol, XLogP of 3.45, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-(1H-indol-4-yl)acetate is sourced from PubChem (CID 143599585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).