About (4E)-4-(methoxymethylidene)-2,5-dimethylpyrazol-3-one
(4E)-4-(methoxymethylidene)-2,5-dimethylpyrazol-3-one (PubChem CID 143599604) has the molecular formula C7H10N2O2
and a molecular weight of 154.17 g/mol. Its IUPAC name is (4E)-4-(methoxymethylidene)-2,5-dimethylpyrazol-3-one.
Molecular Properties
| Compound Name | (4E)-4-(methoxymethylidene)-2,5-dimethylpyrazol-3-one |
| PubChem CID | 143599604 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | (4E)-4-(methoxymethylidene)-2,5-dimethylpyrazol-3-one |
| SMILES | CO/C=C1/C(=O)N(C)N=C1C |
| InChI | InChI=1S/C7H10N2O2/c1-5-6(4-11-3)7(10)9(2)8-5/h4H,1-3H3/b6-4+ |
| InChIKey | GJVVGEGHFNWQKQ-GQCTYLIASA-N |
| XLogP | 0.36 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (4E)-4-(methoxymethylidene)-2,5-dimethylpyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-4-(methoxymethylidene)-2,5-dimethylpyrazol-3-one?
The IUPAC name of (4E)-4-(methoxymethylidene)-2,5-dimethylpyrazol-3-one (CID 143599604) is (4E)-4-(methoxymethylidene)-2,5-dimethylpyrazol-3-one.
What is the SMILES notation for (4E)-4-(methoxymethylidene)-2,5-dimethylpyrazol-3-one?
The canonical SMILES for (4E)-4-(methoxymethylidene)-2,5-dimethylpyrazol-3-one is CO/C=C1/C(=O)N(C)N=C1C.
What is the InChIKey of (4E)-4-(methoxymethylidene)-2,5-dimethylpyrazol-3-one?
The InChIKey is GJVVGEGHFNWQKQ-GQCTYLIASA-N. The full InChI is InChI=1S/C7H10N2O2/c1-5-6(4-11-3)7(10)9(2)8-5/h4H,1-3H3/b6-4+.
What are the key properties of (4E)-4-(methoxymethylidene)-2,5-dimethylpyrazol-3-one?
(4E)-4-(methoxymethylidene)-2,5-dimethylpyrazol-3-one has a molecular weight of 154.17 g/mol, XLogP of 0.36, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-4-(methoxymethylidene)-2,5-dimethylpyrazol-3-one is sourced from PubChem (CID 143599604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).