About 4-(1-ethoxyethylidene)-2,5-dimethylpyrazol-3-one
4-(1-ethoxyethylidene)-2,5-dimethylpyrazol-3-one (PubChem CID 74523708) has the molecular formula C9H14N2O2
and a molecular weight of 182.22 g/mol. Its IUPAC name is 4-(1-ethoxyethylidene)-2,5-dimethylpyrazol-3-one.
Molecular Properties
| Compound Name | 4-(1-ethoxyethylidene)-2,5-dimethylpyrazol-3-one |
| PubChem CID | 74523708 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 4-(1-ethoxyethylidene)-2,5-dimethylpyrazol-3-one |
| SMILES | CCOC(C)=C1C(=O)N(C)N=C1C |
| InChI | InChI=1S/C9H14N2O2/c1-5-13-7(3)8-6(2)10-11(4)9(8)12/h5H2,1-4H3 |
| InChIKey | FTASTZXJZZISHS-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(1-ethoxyethylidene)-2,5-dimethylpyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-ethoxyethylidene)-2,5-dimethylpyrazol-3-one?
The IUPAC name of 4-(1-ethoxyethylidene)-2,5-dimethylpyrazol-3-one (CID 74523708) is 4-(1-ethoxyethylidene)-2,5-dimethylpyrazol-3-one.
What is the SMILES notation for 4-(1-ethoxyethylidene)-2,5-dimethylpyrazol-3-one?
The canonical SMILES for 4-(1-ethoxyethylidene)-2,5-dimethylpyrazol-3-one is CCOC(C)=C1C(=O)N(C)N=C1C.
What is the InChIKey of 4-(1-ethoxyethylidene)-2,5-dimethylpyrazol-3-one?
The InChIKey is FTASTZXJZZISHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2/c1-5-13-7(3)8-6(2)10-11(4)9(8)12/h5H2,1-4H3.
What are the key properties of 4-(1-ethoxyethylidene)-2,5-dimethylpyrazol-3-one?
4-(1-ethoxyethylidene)-2,5-dimethylpyrazol-3-one has a molecular weight of 182.22 g/mol, XLogP of 1.14, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-ethoxyethylidene)-2,5-dimethylpyrazol-3-one is sourced from PubChem (CID 74523708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).