C24H29N3O4 — CID 143599693
N-formyl-4-methyl-6-(2-morpholin-4-ylethoxy)-1,2,3,3a,10,10b-hexahydrocyclopenta[a]carbazole-5-carboxamide (PubChem CID 143599693) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is N-formyl-4-methyl-6-(2-morpholin-4-ylethoxy)-1,2,3,3a,10,10b-hexahydrocyclopenta[a]carbazole-5-carboxamide.
| Compound Name | N-formyl-4-methyl-6-(2-morpholin-4-ylethoxy)-1,2,3,3a,10,10b-hexahydrocyclopenta[a]carbazole-5-carboxamide |
|---|---|
| PubChem CID | 143599693 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | N-formyl-4-methyl-6-(2-morpholin-4-ylethoxy)-1,2,3,3a,10,10b-hexahydrocyclopenta[a]carbazole-5-carboxamide |
| SMILES | CC1=C(C(=O)NC=O)c2c([nH]c3cccc(OCCN4CCOCC4)c23)C2CCCC12 |
| InChI | InChI=1S/C24H29N3O4/c1-15-16-4-2-5-17(16)23-22(20(15)24(29)25-14-28)21-18(26-23)6-3-7-19(21)31-13-10-27-8-11-30-12-9-27/h3,6-7,14,16-17,26H,2,4-5,8-13H2,1H3,(H,25,28,29) |
| InChIKey | OJWQKPVCRTYTMN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|