C23H23FN8O — CID 143602052
N-[(4-fluoro-3-methylphenyl)methyl]-6-[2-[[4-(2H-tetrazol-5-yl)phenyl]methylamino]ethyl]pyrimidine-4-carboxamide (PubChem CID 143602052) has the molecular formula C23H23FN8O and a molecular weight of 446.49 g/mol. Its IUPAC name is N-[(4-fluoro-3-methylphenyl)methyl]-6-[2-[[4-(2H-tetrazol-5-yl)phenyl]methylamino]ethyl]pyrimidine-4-carboxamide.
| Compound Name | N-[(4-fluoro-3-methylphenyl)methyl]-6-[2-[[4-(2H-tetrazol-5-yl)phenyl]methylamino]ethyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 143602052 |
| Molecular Formula | C23H23FN8O |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | N-[(4-fluoro-3-methylphenyl)methyl]-6-[2-[[4-(2H-tetrazol-5-yl)phenyl]methylamino]ethyl]pyrimidine-4-carboxamide |
| SMILES | Cc1cc(CNC(=O)c2cc(CCNCc3ccc(-c4nn[nH]n4)cc3)ncn2)ccc1F |
| InChI | InChI=1S/C23H23FN8O/c1-15-10-17(4-7-20(15)24)13-26-23(33)21-11-19(27-14-28-21)8-9-25-12-16-2-5-18(6-3-16)22-29-31-32-30-22/h2-7,10-11,14,25H,8-9,12-13H2,1H3,(H,26,33)(H,29,30,31,32) |
| InChIKey | WWKJWDGPIQOELP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 121.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|