C6H14N2O2 — CID 143602736
(3R,5R)-3,6,6-trimethyl-1,4,2-dioxazinan-5-amine (PubChem CID 143602736) has the molecular formula C6H14N2O2 and a molecular weight of 146.19 g/mol. Its IUPAC name is (3R,5R)-3,6,6-trimethyl-1,4,2-dioxazinan-5-amine.
| Compound Name | (3R,5R)-3,6,6-trimethyl-1,4,2-dioxazinan-5-amine |
|---|---|
| PubChem CID | 143602736 |
| Molecular Formula | C6H14N2O2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | (3R,5R)-3,6,6-trimethyl-1,4,2-dioxazinan-5-amine |
| SMILES | C[C@@H]1NOC(C)(C)[C@H](N)O1 |
| InChI | InChI=1S/C6H14N2O2/c1-4-8-10-6(2,3)5(7)9-4/h4-5,8H,7H2,1-3H3/t4-,5-/m1/s1 |
| InChIKey | VZKWEGFXEBDFPA-RFZPGFLSSA-N |
| XLogP | -0.05 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |