C13H30N2O2 — CID 143602754
(1R)-1-[[2-(ethoxyamino)-2,6-dimethylheptan-4-yl]amino]ethanol (PubChem CID 143602754) has the molecular formula C13H30N2O2 and a molecular weight of 246.39 g/mol. Its IUPAC name is (1R)-1-[[2-(ethoxyamino)-2,6-dimethylheptan-4-yl]amino]ethanol.
| Compound Name | (1R)-1-[[2-(ethoxyamino)-2,6-dimethylheptan-4-yl]amino]ethanol |
|---|---|
| PubChem CID | 143602754 |
| Molecular Formula | C13H30N2O2 |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.23 |
| IUPAC Name | (1R)-1-[[2-(ethoxyamino)-2,6-dimethylheptan-4-yl]amino]ethanol |
| SMILES | CCONC(C)(C)CC(CC(C)C)N[C@@H](C)O |
| InChI | InChI=1S/C13H30N2O2/c1-7-17-15-13(5,6)9-12(8-10(2)3)14-11(4)16/h10-12,14-16H,7-9H2,1-6H3/t11-,12?/m1/s1 |
| InChIKey | ZTBLRBOSJRVONC-JHJMLUEUSA-N |
| XLogP | 2.04 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|