C19H21N3O2S — CID 143602922
N-[2-amino-5-[(4-methoxyphenyl)methylsulfanyl]phenyl]-2-cyano-2-methylpropanamide (PubChem CID 143602922) has the molecular formula C19H21N3O2S and a molecular weight of 355.46 g/mol. Its IUPAC name is N-[2-amino-5-[(4-methoxyphenyl)methylsulfanyl]phenyl]-2-cyano-2-methylpropanamide.
| Compound Name | N-[2-amino-5-[(4-methoxyphenyl)methylsulfanyl]phenyl]-2-cyano-2-methylpropanamide |
|---|---|
| PubChem CID | 143602922 |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | N-[2-amino-5-[(4-methoxyphenyl)methylsulfanyl]phenyl]-2-cyano-2-methylpropanamide |
| SMILES | COc1ccc(CSc2ccc(N)c(NC(=O)C(C)(C)C#N)c2)cc1 |
| InChI | InChI=1S/C19H21N3O2S/c1-19(2,12-20)18(23)22-17-10-15(8-9-16(17)21)25-11-13-4-6-14(24-3)7-5-13/h4-10H,11,21H2,1-3H3,(H,22,23) |
| InChIKey | JNZUWRJAGQJSPL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|