C34H38NO4PS — CID 143603286
diphenylphosphane;ethyl N-[2-[(2S)-2-benzylcyclopropyl]ethyl]-N-(4-methylphenyl)sulfonylcarbamate (PubChem CID 143603286) has the molecular formula C34H38NO4PS and a molecular weight of 587.72 g/mol. Its IUPAC name is diphenylphosphane;ethyl N-[2-[(2S)-2-benzylcyclopropyl]ethyl]-N-(4-methylphenyl)sulfonylcarbamate.
| Compound Name | diphenylphosphane;ethyl N-[2-[(2S)-2-benzylcyclopropyl]ethyl]-N-(4-methylphenyl)sulfonylcarbamate |
|---|---|
| PubChem CID | 143603286 |
| Molecular Formula | C34H38NO4PS |
| Molecular Weight | 587.72 g/mol |
| Exact Mass | 587.23 |
| IUPAC Name | diphenylphosphane;ethyl N-[2-[(2S)-2-benzylcyclopropyl]ethyl]-N-(4-methylphenyl)sulfonylcarbamate |
| SMILES | CCOC(=O)N(CCC1C[C@H]1Cc1ccccc1)S(=O)(=O)c1ccc(C)cc1.c1ccc(Pc2ccccc2)cc1 |
| InChI | InChI=1S/C22H27NO4S.C12H11P/c1-3-27-22(24)23(28(25,26)21-11-9-17(2)10-12-21)14-13-19-16-20(19)15-18-7-5-4-6-8-18;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h4-12,19-20H,3,13-16H2,1-2H3;1-10,13H/t19?,20-;/m1./s1 |
| InChIKey | QIIGPNUUGITIEV-TVEITMRYSA-N |
| XLogP | 6.73 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.72 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|