C9H18N2O2 — CID 143604684
ethane;2-[ethyl-[(Z)-prop-2-enylideneamino]amino]acetic acid (PubChem CID 143604684) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is ethane;2-[ethyl-[(Z)-prop-2-enylideneamino]amino]acetic acid.
| Compound Name | ethane;2-[ethyl-[(Z)-prop-2-enylideneamino]amino]acetic acid |
|---|---|
| PubChem CID | 143604684 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | ethane;2-[ethyl-[(Z)-prop-2-enylideneamino]amino]acetic acid |
| SMILES | C=C/C=N\N(CC)CC(=O)O.CC |
| InChI | InChI=1S/C7H12N2O2.C2H6/c1-3-5-8-9(4-2)6-7(10)11;1-2/h3,5H,1,4,6H2,2H3,(H,10,11);1-2H3/b8-5-; |
| InChIKey | HJZKQYWWPUDLJG-HGKIGUAWSA-N |
| XLogP | 1.59 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|