C19H26NOPS — CID 143606042
4-methyl-1-(2-phenylethylsulfanyl)-5,6,7,8-tetrahydro-2H-isoquinolin-3-one;methylphosphane (PubChem CID 143606042) has the molecular formula C19H26NOPS and a molecular weight of 347.46 g/mol. Its IUPAC name is 4-methyl-1-(2-phenylethylsulfanyl)-5,6,7,8-tetrahydro-2H-isoquinolin-3-one;methylphosphane.
| Compound Name | 4-methyl-1-(2-phenylethylsulfanyl)-5,6,7,8-tetrahydro-2H-isoquinolin-3-one;methylphosphane |
|---|---|
| PubChem CID | 143606042 |
| Molecular Formula | C19H26NOPS |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 4-methyl-1-(2-phenylethylsulfanyl)-5,6,7,8-tetrahydro-2H-isoquinolin-3-one;methylphosphane |
| SMILES | CP.Cc1c2c(c(SCCc3ccccc3)[nH]c1=O)CCCC2 |
| InChI | InChI=1S/C18H21NOS.CH5P/c1-13-15-9-5-6-10-16(15)18(19-17(13)20)21-12-11-14-7-3-2-4-8-14;1-2/h2-4,7-8H,5-6,9-12H2,1H3,(H,19,20);2H2,1H3 |
| InChIKey | MOFAWFVFVBLTDX-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|