C20H24FN7O2 — CID 143606516
acetylene;N-(5-cyclopropyl-1H-pyrazol-3-yl)-2-[(3R)-3-fluoropyrrolidin-1-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine;methyl formate (PubChem CID 143606516) has the molecular formula C20H24FN7O2 and a molecular weight of 413.46 g/mol. Its IUPAC name is acetylene;N-(5-cyclopropyl-1H-pyrazol-3-yl)-2-[(3R)-3-fluoropyrrolidin-1-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine;methyl formate.
| Compound Name | acetylene;N-(5-cyclopropyl-1H-pyrazol-3-yl)-2-[(3R)-3-fluoropyrrolidin-1-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine;methyl formate |
|---|---|
| PubChem CID | 143606516 |
| Molecular Formula | C20H24FN7O2 |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | acetylene;N-(5-cyclopropyl-1H-pyrazol-3-yl)-2-[(3R)-3-fluoropyrrolidin-1-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine;methyl formate |
| SMILES | C#C.COC=O.F[C@@H]1CCN(c2nc(Nc3cc(C4CC4)[nH]n3)c3cccn3n2)C1 |
| InChI | InChI=1S/C16H18FN7.C2H4O2.C2H2/c17-11-5-7-23(9-11)16-19-15(13-2-1-6-24(13)22-16)18-14-8-12(20-21-14)10-3-4-10;1-4-2-3;1-2/h1-2,6,8,10-11H,3-5,7,9H2,(H2,18,19,20,21,22);2H,1H3;1-2H/t11-;;/m1../s1 |
| InChIKey | JVZCNMGCCILLKD-NVJADKKVSA-N |
| XLogP | 2.66 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|