C26H32N8O3 — CID 143606616
N-(5-cyclopropyl-1H-pyrazol-3-yl)-2-pyrrolidin-1-ylpyrrolo[2,1-f][1,2,4]triazin-4-amine;ethyl benzoate;formamide (PubChem CID 143606616) has the molecular formula C26H32N8O3 and a molecular weight of 504.60 g/mol. Its IUPAC name is N-(5-cyclopropyl-1H-pyrazol-3-yl)-2-pyrrolidin-1-ylpyrrolo[2,1-f][1,2,4]triazin-4-amine;ethyl benzoate;formamide.
| Compound Name | N-(5-cyclopropyl-1H-pyrazol-3-yl)-2-pyrrolidin-1-ylpyrrolo[2,1-f][1,2,4]triazin-4-amine;ethyl benzoate;formamide |
|---|---|
| PubChem CID | 143606616 |
| Molecular Formula | C26H32N8O3 |
| Molecular Weight | 504.60 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | N-(5-cyclopropyl-1H-pyrazol-3-yl)-2-pyrrolidin-1-ylpyrrolo[2,1-f][1,2,4]triazin-4-amine;ethyl benzoate;formamide |
| SMILES | CCOC(=O)c1ccccc1.NC=O.c1cc2c(Nc3cc(C4CC4)[nH]n3)nc(N3CCCC3)nn2c1 |
| InChI | InChI=1S/C16H19N7.C9H10O2.CH3NO/c1-2-8-22(7-1)16-18-15(13-4-3-9-23(13)21-16)17-14-10-12(19-20-14)11-5-6-11;1-2-11-9(10)8-6-4-3-5-7-8;2-1-3/h3-4,9-11H,1-2,5-8H2,(H2,17,18,19,20,21);3-7H,2H2,1H3;1H,(H2,2,3) |
| InChIKey | PLLJJWNGIOXQCP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.60 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|