C25H26N6O4S2 — CID 143608054
N-[4-[4-[[(1R)-1,2-dihydroxyethyl]amino]-2-[3-(methylsulfinimidoyl)anilino]pyrimidin-5-yl]phenyl]benzenesulfonamide (PubChem CID 143608054) has the molecular formula C25H26N6O4S2 and a molecular weight of 538.66 g/mol. Its IUPAC name is N-[4-[4-[[(1R)-1,2-dihydroxyethyl]amino]-2-[3-(methylsulfinimidoyl)anilino]pyrimidin-5-yl]phenyl]benzenesulfonamide.
| Compound Name | N-[4-[4-[[(1R)-1,2-dihydroxyethyl]amino]-2-[3-(methylsulfinimidoyl)anilino]pyrimidin-5-yl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 143608054 |
| Molecular Formula | C25H26N6O4S2 |
| Molecular Weight | 538.66 g/mol |
| Exact Mass | 538.15 |
| IUPAC Name | N-[4-[4-[[(1R)-1,2-dihydroxyethyl]amino]-2-[3-(methylsulfinimidoyl)anilino]pyrimidin-5-yl]phenyl]benzenesulfonamide |
| SMILES | [H]/N=S(\C)c1cccc(Nc2ncc(-c3ccc(NS(=O)(=O)c4ccccc4)cc3)c(N[C@H](O)CO)n2)c1 |
| InChI | InChI=1S/C25H26N6O4S2/c1-36(26)20-7-5-6-19(14-20)28-25-27-15-22(24(30-25)29-23(33)16-32)17-10-12-18(13-11-17)31-37(34,35)21-8-3-2-4-9-21/h2-15,23,26,31-33H,16H2,1H3,(H2,27,28,29,30)/t23-,36?/m1/s1 |
| InChIKey | SKZGGUFZWSBMOO-OSGDARACSA-N |
| XLogP | 3.78 |
| TPSA | 160.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.66 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|