C18H19N5O3S — CID 57446795
4-[[4-(4-aminophenyl)pyrimidin-2-yl]amino]-N-(2-hydroxyethyl)benzenesulfonamide (PubChem CID 57446795) has the molecular formula C18H19N5O3S and a molecular weight of 385.45 g/mol. Its IUPAC name is 4-[[4-(4-aminophenyl)pyrimidin-2-yl]amino]-N-(2-hydroxyethyl)benzenesulfonamide.
| Compound Name | 4-[[4-(4-aminophenyl)pyrimidin-2-yl]amino]-N-(2-hydroxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 57446795 |
| Molecular Formula | C18H19N5O3S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 4-[[4-(4-aminophenyl)pyrimidin-2-yl]amino]-N-(2-hydroxyethyl)benzenesulfonamide |
| SMILES | Nc1ccc(-c2ccnc(Nc3ccc(S(=O)(=O)NCCO)cc3)n2)cc1 |
| InChI | InChI=1S/C18H19N5O3S/c19-14-3-1-13(2-4-14)17-9-10-20-18(23-17)22-15-5-7-16(8-6-15)27(25,26)21-11-12-24/h1-10,21,24H,11-12,19H2,(H,20,22,23) |
| InChIKey | NKNWQOLZRQSFRK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 130.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|