C18H20NO3S+ — CID 143608215
methoxy-(5-methoxy-3-phenyl-4,5-dihydro-1,2-oxazol-4-yl)-(4-methylphenyl)sulfanium (PubChem CID 143608215) has the molecular formula C18H20NO3S+ and a molecular weight of 330.43 g/mol. Its IUPAC name is methoxy-(5-methoxy-3-phenyl-4,5-dihydro-1,2-oxazol-4-yl)-(4-methylphenyl)sulfanium.
| Compound Name | methoxy-(5-methoxy-3-phenyl-4,5-dihydro-1,2-oxazol-4-yl)-(4-methylphenyl)sulfanium |
|---|---|
| PubChem CID | 143608215 |
| Molecular Formula | C18H20NO3S+ |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | methoxy-(5-methoxy-3-phenyl-4,5-dihydro-1,2-oxazol-4-yl)-(4-methylphenyl)sulfanium |
| SMILES | COC1ON=C(c2ccccc2)C1[S+](OC)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H20NO3S/c1-13-9-11-15(12-10-13)23(21-3)17-16(19-22-18(17)20-2)14-7-5-4-6-8-14/h4-12,17-18H,1-3H3/q+1 |
| InChIKey | YEEJOAHQIUNHKS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|