C13H22NO3+ — CID 143608364
[2-(2-hydroxy-3,3-dimethylbutyl)phenyl]-oxoazanium;methanol (PubChem CID 143608364) has the molecular formula C13H22NO3+ and a molecular weight of 240.32 g/mol. Its IUPAC name is [2-(2-hydroxy-3,3-dimethylbutyl)phenyl]-oxoazanium;methanol.
| Compound Name | [2-(2-hydroxy-3,3-dimethylbutyl)phenyl]-oxoazanium;methanol |
|---|---|
| PubChem CID | 143608364 |
| Molecular Formula | C13H22NO3+ |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | [2-(2-hydroxy-3,3-dimethylbutyl)phenyl]-oxoazanium;methanol |
| SMILES | CC(C)(C)C(O)Cc1ccccc1[NH+]=O.CO |
| InChI | InChI=1S/C12H17NO2.CH4O/c1-12(2,3)11(14)8-9-6-4-5-7-10(9)13-15;1-2/h4-7,11,14H,8H2,1-3H3;2H,1H3/p+1 |
| InChIKey | JCOJFBFIICEASW-UHFFFAOYSA-O |
| XLogP | 0.72 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |