C23H6F40N6 — CID 143609864
2,2,3,3,4,4,5,5,6,6-decafluoro-7-N,7-N-bis(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanimidoyl)heptanediimidamide (PubChem CID 143609864) has the molecular formula C23H6F40N6 and a molecular weight of 1126.26 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6-decafluoro-7-N,7-N-bis(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanimidoyl)heptanediimidamide.
| Compound Name | 2,2,3,3,4,4,5,5,6,6-decafluoro-7-N,7-N-bis(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanimidoyl)heptanediimidamide |
|---|---|
| PubChem CID | 143609864 |
| Molecular Formula | C23H6F40N6 |
| Molecular Weight | 1126.26 g/mol |
| Exact Mass | 1126.00 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6-decafluoro-7-N,7-N-bis(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanimidoyl)heptanediimidamide |
| SMILES | [H]/N=C(\N)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)/C(=N\[H])N(/C(=N/[H])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)/C(=N/[H])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C23H6F40N6/c24-5(25,1(64)65)9(32,33)13(40,41)10(34,35)6(26,27)2(66)69(3(67)7(28,29)11(36,37)14(42,43)16(46,47)18(50,51)20(54,55)22(58,59)60)4(68)8(30,31)12(38,39)15(44,45)17(48,49)19(52,53)21(56,57)23(61,62)63/h66-68H,(H3,64,65)/b66-2+,67-3+,68-4+ |
| InChIKey | BZWMQESSUXDFTB-UADFHADESA-N |
| XLogP | 12.08 |
| TPSA | 124.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1126.26 |
| LogP ≤ 5 | 12.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|