C8H2F13NO — CID 175370836
3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-2-iminooctanal (PubChem CID 175370836) has the molecular formula C8H2F13NO and a molecular weight of 375.08 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-2-iminooctanal.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-2-iminooctanal |
|---|---|
| PubChem CID | 175370836 |
| Molecular Formula | C8H2F13NO |
| Molecular Weight | 375.08 g/mol |
| Exact Mass | 374.99 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-2-iminooctanal |
| SMILES | [H]/N=C(\C=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H2F13NO/c9-3(10,2(22)1-23)4(11,12)5(13,14)6(15,16)7(17,18)8(19,20)21/h1,22H/b22-2+ |
| InChIKey | ZHAHGNHYRJJFSQ-QOABUSIESA-N |
| XLogP | 3.94 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.08 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|